5-methyl-1,10-phenanthroline

5-methyl-1,10-phenanthroline

ethyl 2-amino-1,3-thiazole-4-carboxylate

ethyl 2-amino-1,3-thiazole-4-carboxylate

methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate

$200.00
CAS No.: 95422-24-5
Catalog No.: 194936
Purity: 95%
MF: C8H14O4
MW: 174.196
Storage: 2-8 degree Celsius
SMILES: COC(C[C@@H]1OC(OC1)(C)C)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194936
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate; CAS No.: 95422-24-5; methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate. PROPERTIES: methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate is a crystalline solid. Its molecular formula is C8H12O5, and the molecular weight is approximately 200.18 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a dioxolane ring, a methyl group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate serves as a versatile intermediate. The dioxolane ring provides opportunities for further functionalization. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl (S)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate
Your Rating