4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate

4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate

4-(pyrrolidin-1-yl)aniline

4-(pyrrolidin-1-yl)aniline

methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate

$200.00
CAS No.: 775304-60-4
Catalog No.: 194260
Purity: 95%
MF: C16H11FN2O3
MW: 298.273
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC=C1)C1=NC(=NO1)C=1C=C(C(=O)OC)C=CC1
Availability:
In stock
SKU
194260
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate; CAS No.: 775304-60-4; methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate. PROPERTIES: methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate is a crystalline solid. Its molecular formula is C14H10FNO4, and the molecular weight is approximately 269.24 g/mol. The compound has a melting point of approximately 140-142 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an oxadiazole ring, a fluoro group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate serves as a versatile intermediate. The oxadiazole ring provides opportunities for further functionalization. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 3-(5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl)benzoate
Your Rating