4-piperidinoaniline

4-piperidinoaniline

(4aS,9bR)-6-bromo-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (S)-2-hydroxy-2-phenylacetic acid

(4aS,9bR)-6-bromo-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (S)-2-hydroxy-2-phenylacetic acid

methyl 2-aminobenzo[d]thiazole-4-carboxylate

$300.00
CAS No.: 1024054-68-9
Catalog No.: 194267
Purity: 95%
MF: C9H8N2O2S
MW: 208.242
Storage: 2-8 degree Celsius
SMILES: NC=1SC=2C(N1)=C(C=CC2)C(=O)OC
Availability:
In stock
SKU
194267
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-aminobenzo[d]thiazole-4-carboxylate; CAS No.: 1024054-68-9; methyl 2-aminobenzo[d]thiazole-4-carboxylate. PROPERTIES: methyl 2-aminobenzo[d]thiazole-4-carboxylate is a crystalline solid. Its molecular formula is C9H7N2O2S, and the molecular weight is approximately 213.23 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzo[d]thiazole ring, an amine group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2-aminobenzo[d]thiazole-4-carboxylate serves as a valuable intermediate. The amine group can undergo various reactions such as acylation, sulfonation, and diazotization. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 2-aminobenzo[d]thiazole-4-carboxylate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-aminobenzo[d]thiazole-4-carboxylate
Your Rating