ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate hydrochloride
$300.00
CAS No.: 128073-50-7
Catalog No.: 161888
Purity: 95%
MF: C12H16ClNO3
MW: 257.717
Storage: 2-8 degree Celsius
SMILES: Cl.CCOC(=O)C1NCCC2=C1C=CC(O)=C2
Catalog No.: 161888
Purity: 95%
MF: C12H16ClNO3
MW: 257.717
Storage: 2-8 degree Celsius
SMILES: Cl.CCOC(=O)C1NCCC2=C1C=CC(O)=C2
ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate hydrochloride; CAS No.: 128073-50-7; ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate hydrochloride is part of ChemShuttle's collection of various organic chemicals, which are used extensively in chemical research and synthesis. As a various organic chemical with unique structural features, this compound highlights the company's ability to supply specialized building blocks for the development of new pharmaceuticals. The various organic chemicals offered by ChemShuttle, including ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate hydrochloride (CAS No.: 128073-50-7), are essential for enabling researchers to construct complex molecules with potential therapeutic applications. These various organic chemicals serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By supplying a diverse array of various organic chemicals, ChemShuttle ensures that scientists have access to the necessary components to advance their research. The ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate hydrochloride (CAS No.: 128073-50-7) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.
Reviews
Write Your Own Review