7-chloroquinolin-4-ol

7-chloroquinolin-4-ol

7-hydroxyisoquinoline

7-hydroxyisoquinoline

ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate

$300.00
CAS No.: 1809286-36-9
Catalog No.: 194278
Purity: 95%
MF: C19H17NO4
MW: 323.348
Storage: 2-8 degree Celsius
SMILES: OC1=C(N=C(C2=CC(=CC=C12)OC1=CC=CC=C1)C)C(=O)OCC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194278
  • Size
    Price
    Stock
    Estimated Shipping Time
ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate; CAS No.: 1809286-36-9; ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate. PROPERTIES: ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate is a crystalline solid. Its molecular formula is C20H18N2O4, and the molecular weight is approximately 358.37 g/mol. The compound has a melting point of approximately 140-142 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an isoquinoline ring, a hydroxyl group, a phenoxy group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate serves as a valuable intermediate. The hydroxyl group can undergo reactions such as etherification and esterification. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate
Your Rating