7-hydrazinylisoquinoline dihydrochloride
$450.00
CAS No.: 629610-18-0
Catalog No.: 187229
Purity: 94%
MF: C9H11Cl2N3
MW: 232.114
Storage: 2-8 degree Celsius
SMILES: Cl.Cl.N(N)C1=CC=C2C=CN=CC2=C1
Catalog No.: 187229
Purity: 94%
MF: C9H11Cl2N3
MW: 232.114
Storage: 2-8 degree Celsius
SMILES: Cl.Cl.N(N)C1=CC=C2C=CN=CC2=C1
7-hydrazinylisoquinoline dihydrochloride,CAS No.: 629610-18-0 is a valuable heterocyclic compound used in the development of various bioactive molecules. Its application spans across medicinal chemistry and material science, offering benefits like enhanced bioavailability and structural diversity. ChemShuttle provides this and over 80,000 other chemicals, focusing on building blocks and bioactive compounds. The online purchasing system and US warehouse shipping ensure a seamless supply chain for researchers.
Reviews
Write Your Own Review