cis-Octahydro-1H-isoindole hydrochloride
$300.00
CAS No.: 161829-92-1
Catalog No.: 137255
Purity: 95%
MF: C8H16ClN
MW: 161.676
Storage: 2-8 degree Celsius
SMILES: Cl[H].[H][C@@]12CNC[C@]1([H])CCCC2
Catalog No.: 137255
Purity: 95%
MF: C8H16ClN
MW: 161.676
Storage: 2-8 degree Celsius
SMILES: Cl[H].[H][C@@]12CNC[C@]1([H])CCCC2
cis-Octahydro-1H-isoindole hydrochloride; CAS No.: 161829-92-1; ChemShuttle, as a leading chemical synthesis company, offers cis-Octahydro-1H-isoindole hydrochloride (CAS No.: 161829-92-1). This compound exemplifies the company's commitment to providing high-quality chemical building blocks for drug discovery. As a chemical synthesis company, ChemShuttle specializes in producing various organic chemicals that serve as essential intermediates in pharmaceutical research. The hydrochloride salt in CAS No.: 161829-92-1 adds to its structural diversity, making it valuable in custom synthesis projects. Researchers can access this and other screening compounds through ChemShuttle's platform, making it a valuable resource for obtaining key intermediates. The chemical synthesis company continues to expand its offerings of such specialized heterocycles to support advancing scientific research.
Reviews
Write Your Own Review