Ethyl 6-amino-5-methoxy-1H-indole-2-carboxylate
$300.00
CAS No.: 107575-60-0
Catalog No.: 137197
Purity: 95%
MF: C12H14N2O3
MW: 234.255
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CC2=CC(OC)=C(N)C=C2N1
Catalog No.: 137197
Purity: 95%
MF: C12H14N2O3
MW: 234.255
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CC2=CC(OC)=C(N)C=C2N1
Ethyl 6-amino-5-methoxy-1H-indole-2-carboxylate; CAS No.: 107575-60-0; ChemShuttle, as a leading chemical synthesis company, offers a diverse range of heterocycles including Ethyl 6-amino-5-methoxy-1H-indole-2-carboxylate (CAS No.: 107575-60-0). This compound exemplifies the company's commitment to providing high-quality chemical building blocks for drug discovery. As a chemical synthesis company, ChemShuttle specializes in producing various organic chemicals that serve as essential intermediates in pharmaceutical research. The amino and methoxy substitutions in CAS No.: 107575-60-0 add to its structural diversity, making it valuable in custom synthesis projects. Researchers can access this and other screening compounds through ChemShuttle's platform, making it a valuable resource for obtaining key intermediates. The chemical synthesis company continues to expand its offerings of such specialized heterocycles to support advancing scientific research.
Reviews
Write Your Own Review