7-(benzyloxy)-1H-indole
$250.00
CAS No.: 20289-27-4
Catalog No.: 196208
Purity: 95%
MF: C15H13NO
MW: 223.275
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC=1C=CC=C2C=CNC12
Catalog No.: 196208
Purity: 95%
MF: C15H13NO
MW: 223.275
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC=1C=CC=C2C=CNC12
7-(benzyloxy)-1H-indole; CAS No.: 20289-27-4; 7-(benzyloxy)-1H-indole. PROPERTIES: This compound presents a 7-(benzyloxy)-1H-indole structure, combining a benzyloxy group and an indole ring system. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 223.3 g/mol (C16H13NO). The melting point ranges between 90-95 C, and it exhibits moderate solubility in common organic solvents like ethyl acetate, dichloromethane, and tetrahydrofuran while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: 7-(Benzyloxy)-1H-indole serves as a versatile intermediate in pharmaceutical and chemical synthesis. Its 7-(benzyloxy)-1H-indole structure enables diverse reactivity patterns, including benzylic oxidation and nucleophilic substitution at the indole ring. In medicinal chemistry, it is used to develop bioactive molecules targeting kinases, G protein-coupled receptors, and proteases. The benzyloxy group can be removed by hydrogenolysis to release the parent indole for further functionalization. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies employ it as a model compound in Organic Chemistry journals, focusing on the development of novel benzyloxyindole derivatives based on the 7-(benzyloxy)-1H-indole scaffold.
Reviews
Write Your Own Review