6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
$200.00
CAS No.: 1073353-82-8
Catalog No.: 137305
Purity: 95%
MF: C15H19BClNO2
MW: 291.587
Storage: 2-8 degree Celsius
SMILES: CN1C(=CC2=CC=C(Cl)C=C12)B1OC(C)(C)C(C)(C)O1
Catalog No.: 137305
Purity: 95%
MF: C15H19BClNO2
MW: 291.587
Storage: 2-8 degree Celsius
SMILES: CN1C(=CC2=CC=C(Cl)C=C12)B1OC(C)(C)C(C)(C)O1
6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole; CAS No.: 1073353-82-8; ChemShuttle functions as a chemical synthesis company specializing in chlorinated indole derivatives such as 6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS No.: 1073353-82-8). This compound exemplifies the company's focus on offering building blocks for drug discovery with chloro and boronic acid groups. As a chemical synthesis company, ChemShuttle offers various organic chemicals that serve as essential intermediates in pharmaceutical research. The chloro and methyl groups in CAS No.: 1073353-82-8 provide versatile reactivity, making it valuable in custom synthesis projects. Researchers benefit from ChemShuttle's chemical synthesis company services when sourcing such specialized screening compounds, which are often critical for advancing drug discovery initiatives. The company's expertise in chemical synthesis ensures that compounds like this indole derivative meet the high standards required for research applications.
Reviews
Write Your Own Review