5-(trifluoromethyl)-1H-indole-2-carboxylic acid
$295.00
CAS No.: 496946-78-2
Catalog No.: 170247
Purity: 95%
MF: C10H6F3NO2
MW: 229.157
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC2=CC(=CC=C2N1)C(F)(F)F
Catalog No.: 170247
Purity: 95%
MF: C10H6F3NO2
MW: 229.157
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC2=CC(=CC=C2N1)C(F)(F)F
5-(trifluoromethyl)-1H-indole-2-carboxylic acid; CAS No.: 496946-78-2; 5-(trifluoromethyl)-1H-indole-2-carboxylic acid exemplifies ChemShuttle's building blocks for drug discovery. As a worldwide chemical supplier, we provide trifluoromethyl-substituted indole derivatives for research applications. This compound combines a trifluoromethyl group with a carboxylic acid on an indole core, offering interesting electronic properties. ChemShuttle's custom synthesis capabilities ensure precise substitution and high purity. The carboxylic acid group allows for further functionalization, making this compound valuable in creating diverse chemical libraries.
Reviews
Write Your Own Review