5-bromo-1H-indol-3-yl acetate
$250.00
CAS No.: 17357-14-1
Catalog No.: 137117
Purity: 95%
MF: C10H8BrNO2
MW: 254.083
Storage: 2-8 degree Celsius
SMILES: CC(=O)OC1=CNC2=CC=C(Br)C=C12
Catalog No.: 137117
Purity: 95%
MF: C10H8BrNO2
MW: 254.083
Storage: 2-8 degree Celsius
SMILES: CC(=O)OC1=CNC2=CC=C(Br)C=C12
5-bromo-1H-indol-3-yl acetate; CAS No.: 17357-14-1; ChemShuttle, as a leading chemical synthesis company, offers a diverse range of heterocycles including 5-bromo-1H-indol-3-yl acetate (CAS No.: 17357-14-1). This compound exemplifies the company's commitment to providing high-quality chemical building blocks for drug discovery. As a chemical synthesis company, ChemShuttle specializes in producing various organic chemicals that serve as essential intermediates in pharmaceutical research. The bromo substitution in CAS No.: 17357-14-1 adds to its structural diversity, making it valuable in custom synthesis projects. Researchers can access this and other screening compounds through ChemShuttle's platform, making it a valuable resource for obtaining key intermediates. The chemical synthesis company continues to expand its offerings of such specialized heterocycles to support advancing scientific research.
Reviews
Write Your Own Review