3-Formyl-1H-indole-4-carboxylic acid
$200.00
CAS No.: 208772-46-7
Catalog No.: 137316
Purity: 95%
MF: C10H7NO3
MW: 189.17
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C2C(NC=C2C=O)=CC=C1
Catalog No.: 137316
Purity: 95%
MF: C10H7NO3
MW: 189.17
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C2C(NC=C2C=O)=CC=C1
3-Formyl-1H-indole-4-carboxylic acid; CAS No.: 208772-46-7; ChemShuttle, as a leading chemical synthesis company, offers a diverse range of heterocycles including 3-Formyl-1H-indole-4-carboxylic acid (CAS No.: 208772-46-7). This compound exemplifies the company's commitment to providing high-quality chemical building blocks for drug discovery. As a chemical synthesis company, ChemShuttle specializes in producing various organic chemicals that serve as essential intermediates in pharmaceutical research. The formyl group in CAS No.: 208772-46-7 adds to its structural diversity, making it valuable in custom synthesis projects. Researchers can access this and other screening compounds through ChemShuttle's platform, making it a valuable resource for obtaining key intermediates. The chemical synthesis company continues to expand its offerings of such specialized heterocycles to support advancing scientific research.
Reviews
Write Your Own Review