3-(2-chloropyrimidin-4-yl)-1H-indole
$200.00
CAS No.: 945016-63-7
Catalog No.: 137496
Purity: 95%
MF: C12H8ClN3
MW: 229.67
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(=CC=N1)C1=CNC2=CC=CC=C12
Catalog No.: 137496
Purity: 95%
MF: C12H8ClN3
MW: 229.67
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(=CC=N1)C1=CNC2=CC=CC=C12
3-(2-chloropyrimidin-4-yl)-1H-indole; CAS No.: 945016-63-7; 3-(2-chloropyrimidin-4-yl)-1H-indole is a specialty chemical offered by ChemShuttle, a leading chemical synthesis company specializing in custom synthesis services. As part of their extensive library of compounds, this chloropyrimidine-substituted indole serves as a valuable key intermediates for drug discovery. ChemShuttle's expertise in chemical building blocks allows them to provide high-purity 3-(2-chloropyrimidin-4-yl)-1H-indole (CAS No.: 945016-63-7) with exact specifications. Their custom chemical synthesis capabilities ensure that researchers can obtain this CAS No.: 945016-63-7 compound for various organic chemistry applications, knowing it meets stringent quality standards. ChemShuttle's role as a worldwide chemical supplier is further cemented by their ability to supply such specialized building blocks, essential for advancing pharmaceutical and chemical research. The pyrimidine moiety in this compound makes it particularly useful in conjugation reactions, leveraging ChemShuttle's process chemistry strengths.
Reviews
Write Your Own Review