2,3-dihydro-indole-1,6-dicarboxylic acid 1-tert-butyl ester
$250.00
CAS No.: 208772-41-2
Catalog No.: 165190
Purity: 95%
MF: C14H17NO4
MW: 263.293
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC2=CC=C(C=C12)C(O)=O
Catalog No.: 165190
Purity: 95%
MF: C14H17NO4
MW: 263.293
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC2=CC=C(C=C12)C(O)=O
2,3-dihydro-indole-1,6-dicarboxylic acid 1-tert-butyl ester; CAS No.: 208772-41-2; 2,3-dihydro-indole-1,6-dicarboxylic acid 1-tert-butyl ester is a chem block that ChemShuttle offers to support chemical research and synthesis. As a chem block with unique reactivity, this compound illustrates the company's focus on providing essential building blocks for the development of new pharmaceuticals. The chem blocks supplied by ChemShuttle, such as 2,3-dihydro-indole-1,6-dicarboxylic acid 1-tert-butyl ester (CAS No.: 208772-41-2), are crucial for enabling researchers to construct complex molecules with potential therapeutic applications. These chem blocks serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By offering a diverse array of chem blocks, ChemShuttle supports the innovative efforts of scientists in the pharmaceutical industry. The 2,3-dihydro-indole-1,6-dicarboxylic acid 1-tert-butyl ester (CAS No.: 208772-41-2) exemplifies the company's commitment to providing high-quality building blocks that contribute to advances in chemical research.
Reviews
Write Your Own Review