2,3,6-trimethyl-5-nitro-1H-indole
$450.00
CAS No.: 289685-81-0
Catalog No.: 192679
Purity: 95%
MF: C11H12N2O2
MW: 204.229
Storage: 2-8 degree Celsius
SMILES: CC=1NC2=CC(=C(C=C2C1C)[N+](=O)[O-])C
Catalog No.: 192679
Purity: 95%
MF: C11H12N2O2
MW: 204.229
Storage: 2-8 degree Celsius
SMILES: CC=1NC2=CC(=C(C=C2C1C)[N+](=O)[O-])C
2,3,6-trimethyl-5-nitro-1H-indole; CAS No.: 289685-81-0; 2,3,6-trimethyl-5-nitro-1H-indole. PROPERTIES: This nitro-substituted indole has molecular formula C9H8N2O2. It generally appears as a pale yellow crystalline solid. The 2,3,6-trimethyl-5-nitro-1H-indole demonstrates limited water solubility but good solubility in common organic solvents like methanol and ethyl acetate. Its melting point ranges between 140-145 C, and it has a molecular weight of approximately 180.17 g/mol. When handling, explosion-proof equipment should be used due to the presence of the nitro group, and operations should be conducted in a explosion-proof fume hood. Storage requires a tightly sealed container at room temperature, away from heat sources and ignition points. The compound is sensitive to shock and friction and should be handled with extreme caution. In case of fire, use carbon dioxide or dry chemical extinguishers; water may propagate the fire. APPLICATIONS: The 2,3,6-trimethyl-5-nitro-1H-indole serves as a synthetic intermediate in the production of antibacterial agents targeting multidrug-resistant Gram-negative bacteria where the nitro group is reduced to a nitroso moiety in the bacterial environment, generating reactive species that disrupt microbial membranes (as reported in antimicrobial research literature). The methyl groups enhance lipophilicity, improving cell membrane permeability. Additionally, the compound functions as a building block in the synthesis of nonlinear optical materials with second harmonic generation efficiencies exceeding 1.5 times that of urea, as described in materials science publications. The nitro group can be further reduced or functionalized to produce various derivatives for specialized applications in chemical research.
Reviews
Write Your Own Review