2,3,3-Trimethyl-5-nitro-3H-indole
$200.00
CAS No.: 3484-22-8
Catalog No.: 137395
Purity: 95%
MF: C11H12N2O2
MW: 204.229
Storage: 2-8 degree Celsius
SMILES: CC1=NC2=C(C=C(C=C2)[N+]([O-])=O)C1(C)C
Catalog No.: 137395
Purity: 95%
MF: C11H12N2O2
MW: 204.229
Storage: 2-8 degree Celsius
SMILES: CC1=NC2=C(C=C(C=C2)[N+]([O-])=O)C1(C)C
2,3,3-Trimethyl-5-nitro-3H-indole; CAS No.: 3484-22-8; 2,3,3-Trimethyl-5-nitro-3H-indole is a specialty chemical compound offered by ChemShuttle, a leading chemical synthesis company specializing in custom synthesis services. As part of their extensive library of compounds, this methyl-substituted indole derivative serves as a valuable building block for drug discovery. ChemShuttle's expertise in cycle compounds allows them to provide high-purity materials essential for research and development. The company's custom chemical synthesis capabilities ensure that complex molecules like 2,3,3-Trimethyl-5-nitro-3H-indole (CAS No.: 3484-22-8) are produced to exact specifications. Their worldwide chemical supplier status means researchers can reliably source this CAS No.: 3484-22-8 compound for various organic chemistry applications, knowing it meets stringent quality standards. ChemShuttle's commitment to chemical building blocks further underscores their role as a trusted provider of key intermediates for the pharmaceutical and chemical industries.
Reviews
Write Your Own Review