methyl 5-bromo-1H-indazole-7-carboxylate
$250.00
CAS No.: 898747-24-5
Catalog No.: 162993
Purity: 95%
MF: C9H7BrN2O2
MW: 255.071
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(Br)=CC2=C1NN=C2
Catalog No.: 162993
Purity: 95%
MF: C9H7BrN2O2
MW: 255.071
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(Br)=CC2=C1NN=C2
methyl 5-bromo-1H-indazole-7-carboxylate; CAS No.: 898747-24-5; methyl 5-bromo-1H-indazole-7-carboxylate is a chem block that ChemShuttle offers to support chemical research and synthesis. As a chem block with unique reactivity, this compound illustrates the company's focus on providing essential building blocks for the development of new pharmaceuticals. The chem blocks supplied by ChemShuttle, such as methyl 5-bromo-1H-indazole-7-carboxylate (CAS No.: 898747-24-5), are crucial for enabling researchers to construct complex molecules with potential therapeutic applications. These chem blocks serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By offering a diverse array of chem blocks, ChemShuttle supports the innovative efforts of scientists in the pharmaceutical industry. The methyl 5-bromo-1H-indazole-7-carboxylate (CAS No.: 898747-24-5) exemplifies the company's commitment to providing high-quality building blocks that contribute to advances in chemical research.
Reviews
Write Your Own Review