5-bromo-6-chloro-1H-indazole-3-carboxylic acid
$295.00
CAS No.: 1467062-18-5
Catalog No.: 170822
Purity: 95%
MF: C8H4BrClN2O2
MW: 275.489
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NNC2=C1C=C(Br)C(Cl)=C2
Catalog No.: 170822
Purity: 95%
MF: C8H4BrClN2O2
MW: 275.489
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NNC2=C1C=C(Br)C(Cl)=C2
5-bromo-6-chloro-1H-indazole-3-carboxylic acid; CAS No.: 1467062-18-5; ChemShuttle is a chemical synthesis company that deals with screening compounds like 5-bromo-6-chloro-1H-indazole-3-carboxylic acid. This compound is a crucial key intermediate in the development of various pharmaceuticals and specialty chemicals. Our custom chemical synthesis companies division offers Small molecules synthesis services, enabling clients to obtain such complex chemicals for their unique research purposes. By providing high - purity and high - quality compounds, ChemShuttle supports the drug discovery process and chemical innovation, helping researchers to explore new possibilities in the realm of medicinal chemistry and chemical biology.
Reviews
Write Your Own Review