3-bromo-1-methyl-1H-indazol-5-amine
$250.00
CAS No.: 1092351-49-9
Catalog No.: 171668
Purity: 95%
MF: C8H8BrN3
MW: 226.077
Storage: 2-8 degree Celsius
SMILES: CN1N=C(Br)C2=C1C=CC(N)=C2
Catalog No.: 171668
Purity: 95%
MF: C8H8BrN3
MW: 226.077
Storage: 2-8 degree Celsius
SMILES: CN1N=C(Br)C2=C1C=CC(N)=C2
3-bromo-1-methyl-1H-indazol-5-amine; CAS No.: 1092351-49-9; 3-bromo-1-methyl-1H-indazol-5-amine is a heterocycle and a key intermediate. As a product provided by ChemShuttle, a worldwide chemical supplier, it can be used in custom synthesis processes. Its heterocyclic structure along with the bromine and amino functional groups makes it a versatile component for creating more complex molecules. In drug discovery, this compound can serve as a crucial starting point for developing novel chemical entities with potential therapeutic properties. ChemShuttle's custom synthesis services enable researchers to modify and build upon this structure, exploring new chemical frontiers and contributing to the advancement of pharmaceutical research.
Reviews
Write Your Own Review