1-(6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl)ethanone
$264.00
CAS No.: 1333319-78-0
Catalog No.: 188328
Purity: 95%
MF: C15H18BFN2O3
MW: 304.13
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C2C=NN(C2=C1)C(C)=O)B1OC(C(O1)(C)C)(C)C
Catalog No.: 188328
Purity: 95%
MF: C15H18BFN2O3
MW: 304.13
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C2C=NN(C2=C1)C(C)=O)B1OC(C(O1)(C)C)(C)C
1-(6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl)ethanone; CAS No.: 1333319-78-0; 1-(6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl)ethanone is a heterocycle incorporating a boronate ester group, making it a valuable building block for drug discovery through Suzuki-Miyaura coupling reactions. As a key intermediate, it provides a foundation for the synthesis of various organic chemicals and pharmaceutical candidates. ChemShuttle specializes in custom synthesis of such specialized compounds, utilizing our expertise in CRO chemical synthesis to deliver high-quality materials. Our role as a Leading Chemicals Distributor ensures that researchers and pharmaceutical companies can access these essential building blocks, supporting the development of innovative therapeutic agents and chemical research advancements globally.
Reviews
Write Your Own Review