![methyl imidazo[1,2-a]pyridine-6-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/3/136813_1.jpg)
![ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/3/136838_1.jpg)
ethyl 6-aminoimidazo[1,2-a]pyridine-2-carboxylate
$300.00
CAS No.: 158980-21-3
Catalog No.: 136837
Purity: 95%
MF: C10H11N3O2
MW: 205.217
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2C=C(N)C=CC2=N1
Catalog No.: 136837
Purity: 95%
MF: C10H11N3O2
MW: 205.217
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2C=C(N)C=CC2=N1
ethyl 6-aminoimidazo[1,2-a]pyridine-2-carboxylate; CAS No.: 158980-21-3; ChemShuttle, recognized as a chemical synthesis company, offers a range of imidazopyridine derivatives such as ethyl 6-aminoimidazo[1,2-a]pyridine-2-carboxylate (CAS No.: 158980-21-3). This compound exemplifies the company's commitment to providing building blocks for drug discovery with amino functional groups. As a chemical synthesis company, ChemShuttle specializes in producing various organic chemicals that serve as essential intermediates in pharmaceutical research. The ethyl ester and amino groups in CAS No.: 158980-21-3 make it particularly useful in custom synthesis projects targeting bioactive molecules. Researchers can access this and other cycle compounds through ChemShuttle's platform, making it a valuable resource for obtaining key intermediates. The chemical synthesis company continues to expand its offerings of such specialized screening compounds to support advancing scientific research.
Reviews
Write Your Own Review