5-(chloromethyl)-1-methyl-2-nitro-1H-imidazole
$300.00
CAS No.: 87544-76-1
Catalog No.: 139950
Purity: 95%
MF: C5H6ClN3O2
MW: 175.575
Storage: 2-8 degree Celsius
SMILES: CN1C(CCl)=CN=C1[N+]([O-])=O
Catalog No.: 139950
Purity: 95%
MF: C5H6ClN3O2
MW: 175.575
Storage: 2-8 degree Celsius
SMILES: CN1C(CCl)=CN=C1[N+]([O-])=O
5-(chloromethyl)-1-methyl-2-nitro-1H-imidazole; CAS No.: 1204669-58-8 This chemical is crucial in the development of advanced electronic materials, which are used in semiconductors and sensors. Its electrical properties are critical. ChemShuttle supports its production with tailored synthesis and efficient logistics.
Reviews
Write Your Own Review