4-(2-methyl-1H-imidazol-1-yl)benzaldehyde
$200.00
CAS No.: 88427-96-7
Catalog No.: 137873
Purity: 95%
MF: C11H10N2O
MW: 186.214
Storage: 2-8 degree Celsius
SMILES: CC1=NC=CN1C1=CC=C(C=O)C=C1
Catalog No.: 137873
Purity: 95%
MF: C11H10N2O
MW: 186.214
Storage: 2-8 degree Celsius
SMILES: CC1=NC=CN1C1=CC=C(C=O)C=C1
4-(2-methyl-1H-imidazol-1-yl)benzaldehyde; CAS No.: 88427-96-7; 4-(2-methyl-1H-imidazol-1-yl)benzaldehyde is a specialty chemical offered by ChemShuttle, a leading chemical synthesis company specializing in custom synthesis services. As part of their extensive library of compounds, this imidazole-substituted benzaldehyde serves as a valuable building block for drug discovery. ChemShuttle's expertise in chemical building blocks allows them to provide high-purity 4-(2-methyl-1H-imidazol-1-yl)benzaldehyde (CAS No.: 88427-96-7) with exact specifications. Their custom chemical synthesis capabilities ensure that researchers can obtain this CAS No.: 88427-96-7 compound for various organic chemistry applications, knowing it meets stringent quality standards. ChemShuttle's role as a worldwide chemical supplier is further reinforced by their ability to supply such specialized building blocks, essential for advancing pharmaceutical and chemical research. The aldehyde functionality in this compound makes it particularly useful in conjugation reactions, leveraging ChemShuttle's process chemistry strengths.
Reviews
Write Your Own Review