(1-methyl-5-nitro-1H-imidazol-2-yl)methanol
$250.00
CAS No.: 936-05-0
Catalog No.: 138187
Purity: 95%
MF: C5H7N3O3
MW: 157.129
Storage: 2-8 degree Celsius
SMILES: CN1C(CO)=NC=C1[N+]([O-])=O
Catalog No.: 138187
Purity: 95%
MF: C5H7N3O3
MW: 157.129
Storage: 2-8 degree Celsius
SMILES: CN1C(CO)=NC=C1[N+]([O-])=O
(1-methyl-5-nitro-1H-imidazol-2-yl)methanol; CAS No.:936-05-0; (1-methyl-5-nitro-1H-imidazol-2-yl)methanol. As a custom synthesis company, ChemShuttle offers various custom compound synthesis services. The compound (1 - methyl - 5 - nitro - 1H - imidazol - 2 - yl)methanol (CAS No.:936-05-0) can be synthesized through custom compound synthesis. Custom compound synthesis allows for the production of specific chemicals according to individual requirements. ChemShuttle's synthesis team is skilled and experienced in handling various complex synthesis tasks to meet different research and industrial demands.
Reviews
Write Your Own Review