GS-441524
$200.00
CAS No.: 1191237-69-0
Catalog No.: ZB1788
Purity: 95%
MF: C12H13N5O4
MW: 291.267
Storage: 2-8 degree Celsius
SMILES: NC1=NC=NN2C1=CC=C2[C@@]2(O[C@@H]([C@H]([C@H]2O)O)CO)C#N
Catalog No.: ZB1788
Purity: 95%
MF: C12H13N5O4
MW: 291.267
Storage: 2-8 degree Celsius
SMILES: NC1=NC=NN2C1=CC=C2[C@@]2(O[C@@H]([C@H]([C@H]2O)O)CO)C#N
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-carbonitrile; CAS No.: 1191237-69-0 - This compound is a critical component in the synthesis of complex organic molecules, particularly in pharmaceutical research. Its unique properties facilitate the development of new drugs. ChemShuttle's extensive inventory and streamlined purchasing process ensure that researchers can easily obtain the compounds they need.
Reviews
Write Your Own Review