methyl 4-bromo-5-nitrothiophene-2-carboxylate

methyl 4-bromo-5-nitrothiophene-2-carboxylate

5-(thiophen-2-yl)pentanoic acid

5-(thiophen-2-yl)pentanoic acid

(E)-3-(5-nitrofuran-2-yl)acrylaldehyde

$200.00
CAS No.: 52661-56-0
Catalog No.: 194525
Purity: 95%
MF: C7H5NO4
MW: 167.12
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(O1)/C=C/C=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194525
  • Size
    Price
    Stock
    Estimated Shipping Time
(E)-3-(5-nitrofuran-2-yl)acrylaldehyde; CAS No.: 52661-56-0; (E)-3-(5-nitrofuran-2-yl)acrylaldehyde. PROPERTIES: (E)-3-(5-nitrofuran-2-yl)acrylaldehyde is a crystalline solid. Its molecular formula is C8H5NO4, and the molecular weight is approximately 187.14 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a furan ring, a nitro group, and an aldehyde group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, (E)-3-(5-nitrofuran-2-yl)acrylaldehyde serves as a valuable intermediate. The aldehyde group can undergo various reactions such as nucleophilic addition, oxidation, and condensation. The nitro group can be reduced to an amine group. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of (E)-3-(5-nitrofuran-2-yl)acrylaldehyde can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:(E)-3-(5-nitrofuran-2-yl)acrylaldehyde
Your Rating