ethyl 2-amino-1,3-thiazole-4-carboxylate

ethyl 2-amino-1,3-thiazole-4-carboxylate

1,4-diazepane-1-carbaldehyde

1,4-diazepane-1-carbaldehyde

di(thiophen-2-yl)methanone

$240.00
CAS No.: 704-38-1
Catalog No.: 194933
Purity: 95%
MF: C9H6OS2
MW: 194.28
Storage: 2-8 degree Celsius
SMILES: S1C(=CC=C1)C(=O)C=1SC=CC1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194933
  • Size
    Price
    Stock
    Estimated Shipping Time
di(thiophen-2-yl)methanone; CAS No.: 704-38-1; di(thiophen-2-yl)methanone. PROPERTIES: di(thiophen-2-yl)methanone is a crystalline solid. Its molecular formula is C11H8O2S2, and the molecular weight is approximately 244.31 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a ketone group and two thiophene rings, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, di(thiophen-2-yl)methanone serves as a versatile intermediate. The ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. The thiophene rings provide unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of di(thiophen-2-yl)methanone can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:di(thiophen-2-yl)methanone
Your Rating