(R)-8-Methoxy-chroman-4-ylamine
$500.00
CAS No.: 1213595-55-1
Catalog No.: 190814
Purity: 95%
MF: C10H13NO2
MW: 179.219
Storage: 2-8 degree Celsius
SMILES: COC=1C=CC=C2[C@@H](CCOC12)N
Catalog No.: 190814
Purity: 95%
MF: C10H13NO2
MW: 179.219
Storage: 2-8 degree Celsius
SMILES: COC=1C=CC=C2[C@@H](CCOC12)N
(R)-8-Methoxy-chroman-4-ylamine; CAS No.: 1213595-55-1; (R)-8-Methoxy-chroman-4-ylamine is part of ChemShuttle's comprehensive library of cycle compounds, serving as a valuable building block in organic synthesis and drug discovery. This chroman derivative with methoxy and amine substituents offers strategic positions for further chemical modification, making it an attractive intermediate for developing novel pharmaceuticals and chemical entities. ChemShuttle's role as a custom chemical synthesis company is highlighted by their ability to produce (R)-8-Methoxy-chroman-4-ylamine (CAS No.: 1213595-55-1) with consistent quality and reliability. As a leading chemicals distributor, ChemShuttle ensures the availability of this compound to research institutions and industrial laboratories worldwide. Their expertise in blocks chemistry ensures that researchers have access to high-quality intermediates essential for advancing chemical research and development across multiple disciplines.
Reviews
Write Your Own Review