(S)-N-(2-benzoylphenyl)-1-benzylpyrrolidine-2-carboxamide
$300.00
CAS No.: 96293-17-3
Catalog No.: 189813
Purity: 95%
MF: C25H24N2O2
MW: 384.479
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)(=O)C1=C(C=CC=C1)NC(=O)[C@H]1N(CCC1)CC1=CC=CC=C1
Catalog No.: 189813
Purity: 95%
MF: C25H24N2O2
MW: 384.479
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)(=O)C1=C(C=CC=C1)NC(=O)[C@H]1N(CCC1)CC1=CC=CC=C1
(S)-N-(2-benzoylphenyl)-1-benzylpyrrolidine-2-carboxamide; CAS No.: 96293-17-3; (S)-N-(2-benzoylphenyl)-1-benzylpyrrolidine-2-carboxamide is part of Chem Shuttle's collection of chiral pyrrolidine amides that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing carboxamide derivatives with chiral pyrrolidine substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific stereochemical requirements. This compound, with its chiral pyrrolidine and benzyl groups, serves as a valuable building block for the production of chiral drugs and agrochemicals. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in asymmetric synthesis and chiral drug development. The company's expertise in process chemistry ensures that (S)-N-(2-benzoylphenyl)-1-benzylpyrrolidine-2-carboxamide is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review