(R)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride
$668.00
CAS No.: 2089671-70-3
Catalog No.: 189569
Purity: 95%
MF: C7H7BrClF3N2
MW: 291.498
Storage: 2-8 degree Celsius
SMILES: Cl.BrC1=NC=CC(=C1)[C@H](C(F)(F)F)N
Catalog No.: 189569
Purity: 95%
MF: C7H7BrClF3N2
MW: 291.498
Storage: 2-8 degree Celsius
SMILES: Cl.BrC1=NC=CC(=C1)[C@H](C(F)(F)F)N
(R)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride; CAS No.: 2089671-70-3; ChemShuttle offers building blocks such as (R)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride for drug design. As a Library of Compounds, we provide CRO chemical synthesis, ensuring high-purity intermediates for research and development.
Reviews
Write Your Own Review