![6-bromo-5-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/w/l/wlz2387_1.jpg)
6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine
$360.00
CAS No.: 347-40-0
Catalog No.: WLZ1889
Purity: 95%
MF: C9H8F3NO
MW: 203.163
Storage: 2-8 degree Celsius
SMILES: FC(C=1C=CC2=C(NCCO2)C1)(F)F
Catalog No.: WLZ1889
Purity: 95%
MF: C9H8F3NO
MW: 203.163
Storage: 2-8 degree Celsius
SMILES: FC(C=1C=CC2=C(NCCO2)C1)(F)F
CAS NO.: 347-40-0; 6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine. PROPERTIES: This trifluoromethyl-substituted oxazine features a trifluoromethyl group on a benzo[b][1,4]oxazine ring system, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The 6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine typically appears as a white to off-white crystalline solid with moderate solubility in common organic solvents. Its molecular structure includes electron-withdrawing trifluoromethyl group that influences the electronic properties of the aromatic system. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine serves as a valuable intermediate in the synthesis of highly functionalized oxazine compounds and materials with specific electronic properties. The trifluoromethyl group provides a handle for further functionalization through reactions such as nucleophilic substitution. In medicinal chemistry, this compound functions as a building block for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The oxazine framework contributes to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound benefit from its defined substitution pattern, enabling the development of advanced materials with tailored electronic characteristics.
Reviews
Write Your Own Review