![benzo[b]benzo[4,5]thieno[2,3-d]thiophene](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/184367_4.jpg)
![6-fluorobenzo[b]thiophene](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/185898_3.jpg)
dithieno[2,3-d:2',3'-d']benzo[1,2-b:4,5-b']dithiophene-5,10-dione
$480.00
CAS No.: 1446476-79-4
Catalog No.: 184442
Purity: 95%
MF: C14H4O2S4
MW: 332.452
Storage: 2-8 degree Celsius
SMILES: O=C1C2=C(C3=C(S2)C=CS3)C(=O)C2=C1C1=C(S2)C=CS1
Catalog No.: 184442
Purity: 95%
MF: C14H4O2S4
MW: 332.452
Storage: 2-8 degree Celsius
SMILES: O=C1C2=C(C3=C(S2)C=CS3)C(=O)C2=C1C1=C(S2)C=CS1
dithieno[2,3-d:2',3'-d']benzo[1,2-b:4,5-b']dithiophene-5,10-dione; CAS No.: 1446476-79-4; Known for their expertise in cycle compounds, ChemShuttle offers custom chemical synthesis services. These compounds are crucial for various industrial applications, including the production of polymers and specialty chemicals.
Reviews
Write Your Own Review