![6-bromo-1H-benzo[d]imidazole](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/189190_2.jpg)
![5-(1H-benzo[d]imidazol-2-yl)pyridin-2-ol](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/x/h/xh0176_2.jpg)
2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde
$325.00
CAS No.: 106429-59-8
Catalog No.: 189318
Purity: 95%
MF: C8H6N2O2
MW: 162.148
Storage: 2-8 degree Celsius
SMILES: O=C1NC2=C(N1)C=CC(=C2)C=O
Catalog No.: 189318
Purity: 95%
MF: C8H6N2O2
MW: 162.148
Storage: 2-8 degree Celsius
SMILES: O=C1NC2=C(N1)C=CC(=C2)C=O
2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde; CAS No.: 106429-59-8; 2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde represents the oxobenzoimidazole category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle provides access to heterocyclic aldehyde derivatives that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its oxo and aldehyde groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review