![5-[(1,3-dioxo-1,3-dihydro-2-benzofuran-5-yl)oxy]-1,3-dihydro-2-benzofuran-1,3-dione](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/5/157998_2.jpg)
phthalide-6-carboxylic acid
$350.00
CAS No.: 4743-61-7
Catalog No.: 170263
Purity: 95%
MF: C9H6O4
MW: 178.143
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC=C2COC(=O)C2=C1
Catalog No.: 170263
Purity: 95%
MF: C9H6O4
MW: 178.143
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC=C2COC(=O)C2=C1
phthalide-6-carboxylic acid; CAS No.: 4743-61-7; phthalide-6-carboxylic acid represents ChemShuttle's key intermediates for organic synthesis. As a worldwide chemical supplier, we provide phthalide derivatives with carboxylic acid functionality for research applications. This compound combines a phthalide core with a carboxylic acid group, offering versatile reactivity options. ChemShuttle's custom synthesis services enable researchers to access tailored phthalide derivatives with specific substitution patterns. The carboxylic acid group allows for further functionalization, making this compound valuable in creating diverse chemical libraries.
Reviews
Write Your Own Review