6-chloro-2,2-dimethyl-5-nitro-2,3-dihydrobenzofuran
$398.00
CAS No.: 1334614-55-9
Catalog No.: 133969
Purity: 95%
MF: C10H10ClNO3
MW: 227.647
Storage: 2-8 degree Celsius
SMILES: CC1(C)CC2=C(O1)C=C(Cl)C(=C2)[N+]([O-])=O
Catalog No.: 133969
Purity: 95%
MF: C10H10ClNO3
MW: 227.647
Storage: 2-8 degree Celsius
SMILES: CC1(C)CC2=C(O1)C=C(Cl)C(=C2)[N+]([O-])=O
6-chloro-2,2-dimethyl-5-nitro-2,3-dihydrobenzofuran; CAS No.: 1025216-26-5 This chemical is known for its stability and reactivity. It is primarily used in the pharmaceutical industry for the synthesis of complex drug molecules.
Reviews
Write Your Own Review