![5-bromo-4-fluorobenzo[d][1,3]dioxole](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/194949_2.jpg)
1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one
$250.00
CAS No.: 56136-84-6
Catalog No.: 194032
Purity: 95%
MF: C9H7NO5
MW: 209.157
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C=1C(=CC2=C(OCO2)C1)C(C)=O
Catalog No.: 194032
Purity: 95%
MF: C9H7NO5
MW: 209.157
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C=1C(=CC2=C(OCO2)C1)C(C)=O
1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one; CAS No.: 56136-84-6; 1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one. PROPERTIES: 1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one is a crystalline solid with a characteristic odor. It exhibits a molecular weight of 229.19 g/mol and possesses a melting point ranging between 158-160 C. This compound demonstrates moderate solubility in common organic solvents such as dimethyl sulfoxide and dimethylformamide, while being practically insoluble in water. The presence of the nitro group imparts strong electron-withdrawing properties, influencing its chemical reactivity. For proper storage, 1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one should be kept in a tightly sealed container at temperatures below 20 C, protected from light and moisture. Safety precautions include wearing protective gloves, eye protection, and avoiding inhalation of dust, as it may cause respiratory irritation. In case of skin contact, thorough washing with soap and water is recommended. APPLICATIONS: 1-(6-nitrobenzo[d][1,3]dioxol-5-yl)ethan-1-one serves as a valuable intermediate in organic synthesis, particularly in the preparation of complex heterocyclic compounds for pharmaceutical research. Its structural framework is utilized in the development of potential anti-inflammatory agents, where the dioxole ring and nitro substituent contribute to bioactivity. In medicinal chemistry, the compound undergoes various transformations including reduction of the nitro group to amine functionality, enabling further diversification. As a building block, it finds application in the synthesis of bioactive molecules targeting inflammatory pathways, as described in medicinal chemistry literature. Additionally, it functions as a precursor in the preparation of specialized dyes and pigments for imaging applications, where its conjugated system provides desirable optical properties, as evidenced by recent advances in organic materials science.
Reviews
Write Your Own Review