tert-butyl 3-(4-nitrophenyl)azetidine-1-carboxylate
$200.00
CAS No.: 883901-62-0
Catalog No.: GS3769
Purity: 95%
MF: C14H18N2O4
MW: 278.308
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(C=C1)C1CN(C1)C(=O)OC(C)(C)C
Catalog No.: GS3769
Purity: 95%
MF: C14H18N2O4
MW: 278.308
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(C=C1)C1CN(C1)C(=O)OC(C)(C)C
tert-butyl 3-(4-nitrophenyl)azetidine-1-carboxylate; CAS No.: 883901-62-0: A key intermediate in the synthesis of complex heterocycles, this compound is widely used in drug discovery and development. Its advantages include high reactivity and compatibility with various synthetic routes, making it a valuable asset in medicinal chemistry.
Reviews
Write Your Own Review