3-(2,6-dimethoxyphenyl)azetidine hydrochloride
$398.00
CAS No.: 2751750-75-9
Catalog No.: 191544
Purity: 95%
MF: C11H16ClNO2
MW: 229.707
Storage: 2-8 degree Celsius
SMILES: Cl.COC1=C(C(=CC=C1)OC)C1CNC1
Catalog No.: 191544
Purity: 95%
MF: C11H16ClNO2
MW: 229.707
Storage: 2-8 degree Celsius
SMILES: Cl.COC1=C(C(=CC=C1)OC)C1CNC1
3-(2,6-dimethoxyphenyl)azetidine hydrochloride,CAS No.: 2751750-75-9 - Known for its role in the development of bioactive molecules, this compound is crucial in medicinal chemistry for drug discovery. Its structural features allow for diverse modifications, enhancing its utility in creating targeted therapies. ChemShuttle's extensive catalog includes such innovative compounds, facilitating research and development in life sciences. The convenience of online ordering and local warehouse stocking in the U.S. significantly reduces lead times.
Reviews
Write Your Own Review