![1-[(tert-butoxy)carbonyl]-3-cyanoazetidine-3-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171588_1.jpg)
1-[(benzyloxy)carbonyl]-3-methylazetidine-3-carboxylic acid
$180.00
CAS No.: 1143525-35-2
Catalog No.: 171609
Purity: 95%
MF: C13H15NO4
MW: 249.266
Storage: 2-8 degree Celsius
SMILES: CC1(CN(C1)C(=O)OCC1=CC=CC=C1)C(O)=O
Catalog No.: 171609
Purity: 95%
MF: C13H15NO4
MW: 249.266
Storage: 2-8 degree Celsius
SMILES: CC1(CN(C1)C(=O)OCC1=CC=CC=C1)C(O)=O
1-[(benzyloxy)carbonyl]-3-methylazetidine-3-carboxylic acid; CAS No.: 1143525-35-2; 1-[(benzyloxy)carbonyl]-3-methylazetidine-3-carboxylic acid is a chem block provided by ChemShuttle, a leading chemicals distributor. As a pharma building block, it participates in CRO chemical synthesis. The azetidine ring with the protected carboxylic acid and methyl group offers reactive sites for further chemical modifications. It can be used to create molecules that mimic the structure of natural products or to develop new drugs by adding various functional groups. This compound is crucial in the synthesis of pharmaceutical - relevant molecules.
Reviews
Write Your Own Review