Tacrine hydrochloride

Tacrine hydrochloride

N3,N3,N6,N6-tetramethylacridine-3,6-diamine

$300.00
CAS No.: 494-38-2
Catalog No.: 194534
Purity: 95%
MF: C17H19N3
MW: 265.36
Storage: 2-8 degree Celsius
SMILES: CN(C=1C=CC2=CC3=CC=C(C=C3N=C2C1)N(C)C)C
Availability:
In stock
SKU
194534
  • Size
    Price
    Stock
    Estimated Shipping Time
N3,N3,N6,N6-tetramethylacridine-3,6-diamine; CAS No.: 494-38-2; N3,N3,N6,N6-tetramethylacridine-3,6-diamine. PROPERTIES: N3,N3,N6,N6-tetramethylacridine-3,6-diamine is a crystalline solid. Its molecular formula is C16H18N4, and the molecular weight is approximately 262.34 g/mol. The compound has a melting point of approximately 180-182 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an acridine ring and multiple amine groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, N3,N3,N6,N6-tetramethylacridine-3,6-diamine serves as a valuable intermediate. The amine groups can undergo various reactions such as acylation, sulfonation, and diazotization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of N3,N3,N6,N6-tetramethylacridine-3,6-diamine can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:N3,N3,N6,N6-tetramethylacridine-3,6-diamine
Your Rating