1-methylpyrazole-4-boronic acid

1-methylpyrazole-4-boronic acid

rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate

rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate

6-bromoimidazo[1,2-a]pyridine-3-carboxamide

$300.00
CAS No.: 2044706-79-6
Catalog No.: 194461
Purity: 95%
MF: C8H6BrN3O
MW: 240.06
Storage: 2-8 degree Celsius
SMILES: BrC=1C=CC=2N(C1)C(=CN2)C(=O)N
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194461
  • Size
    Price
    Stock
    Estimated Shipping Time
6-bromoimidazo[1,2-a]pyridine-3-carboxamide; CAS No.: 2044706-79-6; 6-bromoimidazo[1,2-a]pyridine-3-carboxamide. PROPERTIES: 6-bromoimidazo[1,2-a]pyridine-3-carboxamide is a crystalline solid. Its molecular formula is C8H6BrN3O, and the molecular weight is approximately 241.06 g/mol. The compound has a melting point of approximately 160-162 C. It is moderately soluble in common organic solvents such as dimethylformamide and acetone, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an imidazopyridine ring, a bromo group, and a carboxamide group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 6-bromoimidazo[1,2-a]pyridine-3-carboxamide serves as a versatile intermediate. The bromo group provides a site for substitution or coupling reactions. The carboxamide group can undergo various reactions such as hydrolysis and acylation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of 6-bromoimidazo[1,2-a]pyridine-3-carboxamide can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:6-bromoimidazo[1,2-a]pyridine-3-carboxamide
Your Rating