2-oxo-2H-chromene-3-carbonitrile

2-oxo-2H-chromene-3-carbonitrile

2,4-bis((trimethylsilyl)oxy)pyrimidine

2,4-bis((trimethylsilyl)oxy)pyrimidine

5-nitrosoquinolin-8-ol

$400.00
CAS No.: 3565-26-2
Catalog No.: 194872
Purity: 95%
MF: C9H6N2O2
MW: 174.159
Storage: 2-8 degree Celsius
SMILES: N(=O)C1=C2C=CC=NC2=C(C=C1)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194872
  • Size
    Price
    Stock
    Estimated Shipping Time
5-nitrosoquinolin-8-ol; CAS No.: 3565-26-2; 5-nitrosoquinolin-8-ol. PROPERTIES: 5-nitrosoquinolin-8-ol is a crystalline solid. Its molecular formula is C9H6N2O2, and the molecular weight is approximately 174.16 g/mol. The compound has a melting point of approximately 150-152 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a quinoline ring, a nitroso group, and a hydroxyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-nitrosoquinolin-8-ol serves as a versatile intermediate. The nitroso group can undergo various reactions such as reduction and oxidation. The hydroxyl group can be converted to other functional groups such as ether or ester. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 5-nitrosoquinolin-8-ol can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-nitrosoquinolin-8-ol
Your Rating