5-methyl-1,10-phenanthroline

5-methyl-1,10-phenanthroline

5-bromo-4-fluorobenzo[d][1,3]dioxole

5-bromo-4-fluorobenzo[d][1,3]dioxole

5-bromo-6-chloro-1H-indol-3-yl octanoate

$250.00
CAS No.: 209347-94-4
Catalog No.: 194944
Purity: 95%
MF: C16H19BrClNO2
MW: 372.69
Storage: 2-8 degree Celsius
SMILES: C(CCCCCCC)(=O)OC1=CNC2=CC(=C(C=C12)Br)Cl
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194944
  • Size
    Price
    Stock
    Estimated Shipping Time
5-bromo-6-chloro-1H-indol-3-yl octanoate; CAS No.: 209347-94-4; 5-bromo-6-chloro-1H-indol-3-yl octanoate. PROPERTIES: 5-bromo-6-chloro-1H-indol-3-yl octanoate is a crystalline solid. Its molecular formula is C16H19BrClNO2, and the molecular weight is approximately 386.70 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an indole ring, a bromo group, a chloro group, and an octanoate ester, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-bromo-6-chloro-1H-indol-3-yl octanoate serves as a valuable intermediate. The bromo and chloro groups provide sites for substitution reactions. The octanoate ester can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 5-bromo-6-chloro-1H-indol-3-yl octanoate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-bromo-6-chloro-1H-indol-3-yl octanoate
Your Rating