5-(3-chlorophenyl)furan-2-carbaldehyde

5-(3-chlorophenyl)furan-2-carbaldehyde

6-chloro-1-methylpyrimidine-2,4(1H,3H)-dione

6-chloro-1-methylpyrimidine-2,4(1H,3H)-dione

5,6-dichloroisobenzofuran-1,3-dione

$300.00
CAS No.: 942-06-3
Catalog No.: 194226
Purity: 95%
MF: C8H2Cl2O3
MW: 217.007
Storage: 2-8 degree Celsius
SMILES: ClC=1C=C2C(OC(C2=CC1Cl)=O)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194226
  • Size
    Price
    Stock
    Estimated Shipping Time
5,6-dichloroisobenzofuran-1,3-dione; CAS No.: 942-06-3; 5,6-dichloroisobenzofuran-1,3-dione. PROPERTIES: 5,6-dichloroisobenzofuran-1,3-dione is a crystalline solid. Its molecular formula is C8H2Cl2O3, and the molecular weight is approximately 211.01 g/mol. The compound has a melting point of approximately 150-152 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an isobenzofuranone ring and two chloro groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5,6-dichloroisobenzofuran-1,3-dione serves as a valuable intermediate. The two chloro groups provide sites for substitution reactions. The isobenzofuranone ring offers unique electronic effects. In the chemical industry, derivatives of this compound can be explored as potential intermediates for the synthesis of various organic compounds. For example, in the development of certain agrochemicals, the structure of 5,6-dichloroisobenzofuran-1,3-dione can be utilized to design compounds with improved herbicidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5,6-dichloroisobenzofuran-1,3-dione
Your Rating