4-methyl-5-nitropicolinic acid
$250.00
CAS No.: 5832-43-9
Catalog No.: 102888
Purity: 95%
MF: C7H6N2O4
MW: 182.135
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=NC=C1[N+]([O-])=O)C(O)=O
Catalog No.: 102888
Purity: 95%
MF: C7H6N2O4
MW: 182.135
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=NC=C1[N+]([O-])=O)C(O)=O
4-methyl-5-nitropicolinic acid; CAS No.: 5832-43-9; 4-methyl-5-nitropicolinic acid is a crucial key intermediate in our product line. Operating as a chemical synthesis company, ChemShuttle delivers high-performance compounds for pharmaceutical and specialty chemical applications, backed by rigorous quality control and technical support.
Reviews
Write Your Own Review