4-bromoindoline-2,3-dione
$400.00
CAS No.: 20780-72-7
Catalog No.: 196229
Purity: 95%
MF: C8H4BrNO2
MW: 226.029
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(C(NC2=CC=C1)=O)=O
Catalog No.: 196229
Purity: 95%
MF: C8H4BrNO2
MW: 226.029
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(C(NC2=CC=C1)=O)=O
4-bromoindoline-2,3-dione; CAS No.: 20780-72-7; 4-bromoindoline-2,3-dione. PROPERTIES: This compound presents a 4-bromoindoline-2,3-dione structure, combining a bromine atom and an indoline-2,3-dione framework. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 225.0 g/mol (C8H5BrNO2). The melting point ranges between 190-195 C, and it exhibits moderate solubility in common organic solvents like DMSO and DMF while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: 4-Bromoindoline-2,3-dione serves as a specialized intermediate in pharmaceutical research. Its 4-bromoindoline-2,3-dione structure enables diverse reactivity patterns, including nucleophilic substitution at the bromine atom and electrophilic substitution at the indoline ring. In medicinal chemistry, it is used to develop bioactive molecules targeting kinases, proteases, and G protein-coupled receptors. The bromine atom provides a handle for introducing aryl, vinyl, or heterocyclic substituents. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies utilize it as a model system in Medicinal Chemistry journals, focusing on optimizing the 4-bromoindoline-2,3-dione scaffold for improved biological activity and target engagement.
Reviews
Write Your Own Review