2-(2-chloroethyl)thiophene

2-(2-chloroethyl)thiophene

1-(5-iodothiophen-2-yl)ethanone

1-(5-iodothiophen-2-yl)ethanone

3,6-dichlorobenzo[b]thiophene-2-carboxylic acid

$200.00
CAS No.: 34576-94-8
Catalog No.: 194479
Purity: 95%
MF: C9H4Cl2O2S
MW: 247.102
Storage: 2-8 degree Celsius
SMILES: ClC=1C2=C(SC1C(=O)O)C=C(C=C2)Cl
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194479
  • Size
    Price
    Stock
    Estimated Shipping Time
3,6-dichlorobenzo[b]thiophene-2-carboxylic acid; CAS No.: 34576-94-8; 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid. PROPERTIES: 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid is a crystalline solid. Its molecular formula is C8H4Cl2O2S, and the molecular weight is approximately 253.68 g/mol. The compound has a melting point of approximately 130-132 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzo[b]thiophene ring and two chlorine atoms, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid serves as a versatile intermediate. The chlorine atoms provide sites for substitution reactions. The carboxylic acid group can undergo reactions such as esterification and amidation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3,6-dichlorobenzo[b]thiophene-2-carboxylic acid
Your Rating