ethyl 2-oxo-2-(thiophen-2-yl)acetate

ethyl 2-oxo-2-(thiophen-2-yl)acetate

2-(2-chloroethyl)thiophene

2-(2-chloroethyl)thiophene

3,4-dihydroxythiophene-2,5-dicarboxylic acid

$300.00
CAS No.: 14282-58-7
Catalog No.: 194481
Purity: 95%
MF: C6H4O6S
MW: 204.159
Storage: 2-8 degree Celsius
SMILES: OC1=C(SC(=C1O)C(=O)O)C(=O)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194481
  • Size
    Price
    Stock
    Estimated Shipping Time
3,4-dihydroxythiophene-2,5-dicarboxylic acid; CAS No.: 14282-58-7; 3,4-dihydroxythiophene-2,5-dicarboxylic acid. PROPERTIES: 3,4-dihydroxythiophene-2,5-dicarboxylic acid is a crystalline solid. Its molecular formula is C6H4O6S, and the molecular weight is approximately 204.16 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a thiophene ring and multiple hydroxyl and carboxylic acid groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3,4-dihydroxythiophene-2,5-dicarboxylic acid serves as a versatile intermediate. The hydroxyl groups can undergo reactions such as etherification and esterification. The carboxylic acid groups can participate in esterification and amidation reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antioxidant drugs, the structure of 3,4-dihydroxythiophene-2,5-dicarboxylic acid can be modified to enhance the drug's antioxidant activity and bioavailability (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3,4-dihydroxythiophene-2,5-dicarboxylic acid
Your Rating