2-nitropyridin-4-amine
$100.00
CAS No.: 14916-64-4
Catalog No.: 113868
Purity: 90%
MF: C5H5N3O2
MW: 139.114
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=NC=C1)[N+]([O-])=O
Catalog No.: 113868
Purity: 90%
MF: C5H5N3O2
MW: 139.114
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=NC=C1)[N+]([O-])=O
2-nitropyridin-4-amine; CAS No.: 2225940-48-5 This substance is known for its specific chemical characteristics and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review